Besta Urolithin B duftið (1139-83-9) Framleiðandi og verksmiðja

Urolithin B duft

Nóvember 9, 2020

Urolithin BSpecifications

heiti: Urolithin B
Efnaheiti: 3-hýdroxý-6H-díbensó [b, d] pýran-6-ón
CAS: 1139-83-9
Efnaformúla: C13H8O3
Mólþyngd: X
Litur:  Hvítt duft
InChi lykill: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kóði: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Aðgerð: Urolithin B getur bætt starfsemi hvatbera og vöðva.

Urolithin B getur bætt vöðvastyrk og þrek meðan á öldrun stendur.

Umsókn: Urolithin B er örveru umbrotsefni ellagitannis í þörmum og hefur öfluga andoxunar- og foroxunarvirkni, allt eftir greiningarkerfi og aðstæðum. Urolithin B getur einnig sýnt estrógen- og / eða and-estrógenvirkni.
Leysni: Auðveldlega leysanlegt í N, N-dímetýlformamíði og dímetýlmetýleni. Súlfón, örlítið leysanlegt í metanóli, etanóli og etýlasetati
Geymsla Temp: Hygroscopic, -20 ° C Frystir, undir óvirkum andrúmslofti
Sendingarástand: Sendt við umhverfishita sem hættulegt efni. Þessi vara er stöðug nóg í nokkrar vikur á venjulegum skipum og tíma í tollum.

 

Urolithin B NMR litróf

Urolithin B (1139-83-9) - NMR litróf

 

Ef þú þarft COA, MSDS, HNMR fyrir hverja vöruhóp og aðrar upplýsingar, vinsamlegast hafðu samband við okkar markaðsstjóri.